Difference between revisions of "SJ21101"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ADENOSINE_DIPHOSPHATE_RIBOSE ADENOSINE_DIPHOSPHATE_RIBOSE] == * common-name: ** adp-d-ribose *...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-Prime-Phosphate-Terminated-RNAs 3-Prime-Phosphate-Terminated-RNAs] == * common-name: ** an [r...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ADENOSINE_DIPHOSPHATE_RIBOSE ADENOSINE_DIPHOSPHATE_RIBOSE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-Prime-Phosphate-Terminated-RNAs 3-Prime-Phosphate-Terminated-RNAs] ==
 
* common-name:
 
* common-name:
** adp-d-ribose
+
** an [rna]-3'-ribonucleoside-3'-phosphate
* smiles:
 
** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(op([o-])(=o)occ4(c(o)c(o)c(o4)o))(=o)[o-]
 
* inchi-key:
 
** srnwougrcwsemx-tyasjmozsa-l
 
* molecular-weight:
 
** 557.303
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ARDP]]
+
* [[RNA-3-PHOSPHATE-CYCLASE-RXN]]
* [[RXN0-1441]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=adp-d-ribose}}
+
{{#set: common-name=an [rna]-3'-ribonucleoside-3'-phosphate}}
{{#set: inchi-key=inchikey=srnwougrcwsemx-tyasjmozsa-l}}
 
{{#set: molecular-weight=557.303}}
 

Revision as of 14:20, 26 August 2019

Metabolite 3-Prime-Phosphate-Terminated-RNAs

  • common-name:
    • an [rna]-3'-ribonucleoside-3'-phosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "an [rna]-3'-ribonucleoside-3'-phosphate" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.