Difference between revisions of "SJ21107"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LINOLEIC_ACID LINOLEIC_ACID] == * common-name: ** linoleate * smiles: ** cccccc=ccc=ccccccccc([...")
 
(Created page with "Category:gene == Gene SJ21107 == * transcription-direction: ** positive * right-end-position: ** 188214 * left-end-position: ** 176253 * centisome-position: ** 29.1616...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LINOLEIC_ACID LINOLEIC_ACID] ==
+
== Gene SJ21107 ==
* common-name:
+
* transcription-direction:
** linoleate
+
** positive
* smiles:
+
* right-end-position:
** cccccc=ccc=ccccccccc([o-])=o
+
** 188214
* inchi-key:
+
* left-end-position:
** oyhqolukzrvurq-hzjyttrnsa-m
+
** 176253
* molecular-weight:
+
* centisome-position:
** 279.442
+
** 29.1616   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[LIPOXYGENASE-RXN]]
+
* [[S.japonica_carotenoid_curated]]
* [[LNLCCOAL]]
+
== Reaction(s) associated ==
* [[RXN-9673]]
+
* [[RXN-7953]]
== Reaction(s) known to produce the compound ==
+
** Category: [[annotation]]
* [[FACOAE182]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
* [[LINOLEOYL-RXN]]
+
* [[RXN-7954]]
== Reaction(s) of unknown directionality ==
+
** Category: [[annotation]]
{{#set: common-name=linoleate}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
{{#set: inchi-key=inchikey=oyhqolukzrvurq-hzjyttrnsa-m}}
+
== Pathway(s) associated ==
{{#set: molecular-weight=279.442}}
+
* [[PWY-6568]]
 +
** '''2''' reactions found over '''4''' reactions in the full pathway
 +
* [[PWY-6567]]
 +
** '''2''' reactions found over '''5''' reactions in the full pathway
 +
{{#set: transcription-direction=positive}}
 +
{{#set: right-end-position=188214}}
 +
{{#set: left-end-position=176253}}
 +
{{#set: centisome-position=29.1616    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=2}}
 +
{{#set: nb pathway associated=2}}

Latest revision as of 11:00, 18 March 2021

Gene SJ21107

  • transcription-direction:
    • positive
  • right-end-position:
    • 188214
  • left-end-position:
    • 176253
  • centisome-position:
    • 29.1616

Organism(s) associated with this gene

Reaction(s) associated

Pathway(s) associated

  • PWY-6568
    • 2 reactions found over 4 reactions in the full pathway
  • PWY-6567
    • 2 reactions found over 5 reactions in the full pathway