Difference between revisions of "SJ21107"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-SELENOCYSTEINE L-SELENOCYSTEINE] == * common-name: ** l-selenocysteine * smiles: ** c([se])c(...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13717 CPD-13717] == * common-name: ** l-selenocystathionine * smiles: ** c([se]cc(c([o-])=o...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13717 CPD-13717] == |
* common-name: | * common-name: | ||
− | ** l- | + | ** l-selenocystathionine |
* smiles: | * smiles: | ||
− | ** c([se]) | + | ** c([se]cc(c([o-])=o)[n+])cc([n+])c(=o)[o-] |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** znwydqpouqrdly-whfbiakzsa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 269.159 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-12729]] | ||
+ | * [[RXN-15137]] | ||
+ | == Reaction(s) known to produce the compound == | ||
* [[ACHMSSELCYSL]] | * [[ACHMSSELCYSL]] | ||
* [[ACHMSSELCYSLh]] | * [[ACHMSSELCYSLh]] | ||
* [[RXN-12728]] | * [[RXN-12728]] | ||
− | |||
* [[SUCHMSSELCYSL]] | * [[SUCHMSSELCYSL]] | ||
* [[SUCHMSSELCYSLh]] | * [[SUCHMSSELCYSLh]] | ||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name=l- | + | {{#set: common-name=l-selenocystathionine}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=znwydqpouqrdly-whfbiakzsa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=269.159}} |
Revision as of 09:23, 27 August 2019
Contents
Metabolite CPD-13717
- common-name:
- l-selenocystathionine
- smiles:
- c([se]cc(c([o-])=o)[n+])cc([n+])c(=o)[o-]
- inchi-key:
- znwydqpouqrdly-whfbiakzsa-n
- molecular-weight:
- 269.159