Difference between revisions of "SJ21125"

Revision as of 14:20, 26 August 2019

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ITP ITP] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19070 CPD-19070] ==
 * common-name:
-** itp
+** (25s)-26-hydroxycholesterol
 * smiles:
-** c(op(=o)([o-])op([o-])(=o)op([o-])([o-])=o)c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc=nc=23)))
+** cc(co)cccc(c)[ch]3(cc[ch]4([ch]2(cc=c1(cc(o)ccc(c)1[ch]2ccc(c)34))))
 * inchi-key:
-** haejpqiatwhalx-kqynxxcusa-j
+** fyhrjwmencaljy-vicxtrefsa-n
 * molecular-weight:
-** 504.137
+** 402.659
 == Reaction(s) known to consume the compound ==
-* [[ATP-DEAMINASE-RXN]]
+* [[RXN-17653]]
-* [[ITCY]]
-* [[ITPP]]
-* [[ITUP]]
-* [[RXN-14120]]
-* [[RXN0-5073]]
-* [[RXN0-6382]]
 == Reaction(s) known to produce the compound ==
-* [[ATID]]
+* [[RXN-17655]]
-* [[ATIDm]]
-* [[ATP-DEAMINASE-RXN]]
-* [[RXN-14120]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=itp}}
+{{#set: common-name=(25s)-26-hydroxycholesterol}}
-{{#set: inchi-key=inchikey=haejpqiatwhalx-kqynxxcusa-j}}
+{{#set: inchi-key=inchikey=fyhrjwmencaljy-vicxtrefsa-n}}
-{{#set: molecular-weight=504.137}}
+{{#set: molecular-weight=402.659}}