Difference between revisions of "SJ21190"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-734 CPD-734] == * common-name: ** (-)-jasmonate * smiles: ** ccc=ccc1(c(=o)ccc1cc([o-])=o)...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-190 CPD-190] == * common-name: ** n-acetyl-α-d-glucosaminyl-diphosphodolichol == Reac...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-734 CPD-734] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-190 CPD-190] ==
 
* common-name:
 
* common-name:
** (-)-jasmonate
+
** n-acetyl-α-d-glucosaminyl-diphosphodolichol
* smiles:
 
** ccc=ccc1(c(=o)ccc1cc([o-])=o)
 
* inchi-key:
 
** znjfbwydhiglcu-hwkxxfmvsa-m
 
* molecular-weight:
 
** 209.264
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[2.4.1.141-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10767]]
+
* [[2.7.8.15-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(-)-jasmonate}}
+
{{#set: common-name=n-acetyl-α-d-glucosaminyl-diphosphodolichol}}
{{#set: inchi-key=inchikey=znjfbwydhiglcu-hwkxxfmvsa-m}}
 
{{#set: molecular-weight=209.264}}
 

Revision as of 14:20, 26 August 2019

Metabolite CPD-190

  • common-name:
    • n-acetyl-α-d-glucosaminyl-diphosphodolichol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality