Difference between revisions of "SJ21284"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7158 CPD-7158] == * common-name: ** 3-demethylubiquinol-9 * smiles: ** cc(c)=cccc(c)=cccc(c...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-Ketopimeloyl-ACP-methyl-esters 3-Ketopimeloyl-ACP-methyl-esters] == * common-name: ** a 3-oxo...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7158 CPD-7158] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-Ketopimeloyl-ACP-methyl-esters 3-Ketopimeloyl-ACP-methyl-esters] ==
 
* common-name:
 
* common-name:
** 3-demethylubiquinol-9
+
** a 3-oxo-pimeloyl-[acp] methyl ester
* smiles:
 
** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(=c(c)c(o)=c(o)c(oc)=c(o)1)
 
* inchi-key:
 
** alajatogwwbpqt-nscwjznlsa-n
 
* molecular-weight:
 
** 783.228
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.1.1.64-RXN]]
+
* [[RXN-11480]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-11479]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-demethylubiquinol-9}}
+
{{#set: common-name=a 3-oxo-pimeloyl-[acp] methyl ester}}
{{#set: inchi-key=inchikey=alajatogwwbpqt-nscwjznlsa-n}}
 
{{#set: molecular-weight=783.228}}
 

Revision as of 09:25, 27 August 2019

Metabolite 3-Ketopimeloyl-ACP-methyl-esters

  • common-name:
    • a 3-oxo-pimeloyl-[acp] methyl ester

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a 3-oxo-pimeloyl-[acp] methyl ester" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.