Difference between revisions of "SJ21291"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13378 CPD-13378] == * common-name: ** xllg xyloglucan oligosaccharide * smiles: ** c9(c(c(c...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLUCOSYL-GLYCOGENIN GLUCOSYL-GLYCOGENIN] == * common-name: ** an α-d-glucosyl-[glycogenin...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13378 CPD-13378] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLUCOSYL-GLYCOGENIN GLUCOSYL-GLYCOGENIN] ==
 
* common-name:
 
* common-name:
** xllg xyloglucan oligosaccharide
+
** an α-d-glucosyl-[glycogenin]
* smiles:
 
** c9(c(c(c(c(occ8(oc(oc3(c(o)c(o)c(oc(coc1(c(c(c(co1)o)o)oc2(c(c(c(c(o2)co)o)o)o)))3)oc6(c(o)c(o)c(oc(coc4(c(c(c(co4)o)o)oc5(c(c(c(c(o5)co)o)o)o)))6)oc7(c(o)c(o)c(o)oc(co)7))))c(o)c(o)c(o)8))o9)o)o)o)
 
* inchi-key:
 
** gschigxdtvyeem-migiythbsa-n
 
* molecular-weight:
 
** 1387.215
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-12400]]
+
* [[RXN-7667]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[GLYCOGENIN-GLUCOSYLTRANSFERASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=xllg xyloglucan oligosaccharide}}
+
{{#set: common-name=an α-d-glucosyl-[glycogenin]}}
{{#set: inchi-key=inchikey=gschigxdtvyeem-migiythbsa-n}}
 
{{#set: molecular-weight=1387.215}}
 

Revision as of 09:24, 27 August 2019

Metabolite GLUCOSYL-GLYCOGENIN

  • common-name:
    • an α-d-glucosyl-[glycogenin]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "an α-d-glucosyl-[glycogenin" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.