Difference between revisions of "SJ21294"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=METHYLARSONITE METHYLARSONITE] == * common-name: ** methylarsonite * smiles: ** c[as](o)o * inc...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19159 CPD-19159] == * common-name: ** (s)-3-hydroxy-(11z)-octadecenoyl-coa * smiles: ** ccc...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=METHYLARSONITE METHYLARSONITE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19159 CPD-19159] ==
 
* common-name:
 
* common-name:
** methylarsonite
+
** (s)-3-hydroxy-(11z)-octadecenoyl-coa
 
* smiles:
 
* smiles:
** c[as](o)o
+
** ccccccc=ccccccccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
* inchi-key:
** oxbirpqqkcqwgv-uhfffaoysa-n
+
** scdxbwnpjageek-kboaxvdlsa-j
 
* molecular-weight:
 
* molecular-weight:
** 123.971
+
** 1043.952
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.1.1.138-RXN]]
+
* [[RXN-17786]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-17785]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=methylarsonite}}
+
{{#set: common-name=(s)-3-hydroxy-(11z)-octadecenoyl-coa}}
{{#set: inchi-key=inchikey=oxbirpqqkcqwgv-uhfffaoysa-n}}
+
{{#set: inchi-key=inchikey=scdxbwnpjageek-kboaxvdlsa-j}}
{{#set: molecular-weight=123.971}}
+
{{#set: molecular-weight=1043.952}}

Revision as of 14:20, 26 August 2019

Metabolite CPD-19159

  • common-name:
    • (s)-3-hydroxy-(11z)-octadecenoyl-coa
  • smiles:
    • ccccccc=ccccccccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • scdxbwnpjageek-kboaxvdlsa-j
  • molecular-weight:
    • 1043.952

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality