Difference between revisions of "SJ21312"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Methionine-synthase-cob-II-alamins Methionine-synthase-cob-II-alamins] == * common-name: ** a [...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10488 CPD-10488] == * common-name: ** n-formyl-d-kynurenine * smiles: ** c(=o)nc1(c(c(=o)cc...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Methionine-synthase-cob-II-alamins Methionine-synthase-cob-II-alamins] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10488 CPD-10488] ==
 
* common-name:
 
* common-name:
** a [methionine synthase]-cob(ii)alamin
+
** n-formyl-d-kynurenine
 +
* smiles:
 +
** c(=o)nc1(c(c(=o)cc([n+])c(=o)[o-])=cc=cc=1)
 +
* inchi-key:
 +
** byhjhxptqmmkca-uhfffaoysa-n
 +
* molecular-weight:
 +
** 236.227
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.1.1.135-RXN]]
+
* [[RXN-8664]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a [methionine synthase]-cob(ii)alamin}}
+
{{#set: common-name=n-formyl-d-kynurenine}}
 +
{{#set: inchi-key=inchikey=byhjhxptqmmkca-uhfffaoysa-n}}
 +
{{#set: molecular-weight=236.227}}

Revision as of 09:24, 27 August 2019

Metabolite CPD-10488

  • common-name:
    • n-formyl-d-kynurenine
  • smiles:
    • c(=o)nc1(c(c(=o)cc([n+])c(=o)[o-])=cc=cc=1)
  • inchi-key:
    • byhjhxptqmmkca-uhfffaoysa-n
  • molecular-weight:
    • 236.227

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality