Difference between revisions of "SJ21325"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-321 CPD-321] == * common-name: ** 3-aci-nitropropanoate * smiles: ** c(cc([o-])=o)=[n+]([o-...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Uracil-54-in-tRNA Uracil-54-in-tRNA] == * common-name: ** a uracil54 in trna == Reaction(s) kno...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-321 CPD-321] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Uracil-54-in-tRNA Uracil-54-in-tRNA] ==
 
* common-name:
 
* common-name:
** 3-aci-nitropropanoate
+
** a uracil54 in trna
* smiles:
 
** c(cc([o-])=o)=[n+]([o-])[o-]
 
* inchi-key:
 
** kxxxivrxvxkxpa-uhfffaoysa-m
 
* molecular-weight:
 
** 117.061
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-16322]]
+
* [[TRNA-URACIL-5--METHYLTRANSFERASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-aci-nitropropanoate}}
+
{{#set: common-name=a uracil54 in trna}}
{{#set: inchi-key=inchikey=kxxxivrxvxkxpa-uhfffaoysa-m}}
 
{{#set: molecular-weight=117.061}}
 

Revision as of 14:20, 26 August 2019

Metabolite Uracil-54-in-tRNA

  • common-name:
    • a uracil54 in trna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality