Difference between revisions of "SJ21325"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Uracil-54-in-tRNA Uracil-54-in-tRNA] == * common-name: ** a uracil54 in trna == Reaction(s) kno...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14594 CPD-14594] == * common-name: ** linustatin * smiles: ** cc(oc2(oc(coc1(oc(co)c(o)c(o)...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14594 CPD-14594] == |
* common-name: | * common-name: | ||
| − | ** | + | ** linustatin |
| + | * smiles: | ||
| + | ** cc(oc2(oc(coc1(oc(co)c(o)c(o)c(o)1))c(o)c(o)c(o)2))(c#n)c | ||
| + | * inchi-key: | ||
| + | ** fersmfqbwvbkqk-cxttvelosa-n | ||
| + | * molecular-weight: | ||
| + | ** 409.389 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-13602]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=linustatin}} |
| + | {{#set: inchi-key=inchikey=fersmfqbwvbkqk-cxttvelosa-n}} | ||
| + | {{#set: molecular-weight=409.389}} | ||
Revision as of 09:24, 27 August 2019
Contents
Metabolite CPD-14594
- common-name:
- linustatin
- smiles:
- cc(oc2(oc(coc1(oc(co)c(o)c(o)c(o)1))c(o)c(o)c(o)2))(c#n)c
- inchi-key:
- fersmfqbwvbkqk-cxttvelosa-n
- molecular-weight:
- 409.389
