Difference between revisions of "SJ21359"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17328 CPD-17328] == * common-name: ** (9z,12z,15z,18z)-tetracosatetraenoyl-coa * smiles: **...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-578 CPD-578] == * common-name: ** urea-1-carboxylate * smiles: ** c(n)(nc([o-])=o)=o * inch...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17328 CPD-17328] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-578 CPD-578] ==
 
* common-name:
 
* common-name:
** (9z,12z,15z,18z)-tetracosatetraenoyl-coa
+
** urea-1-carboxylate
 
* smiles:
 
* smiles:
** cccccc=ccc=ccc=ccc=ccccccccc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
+
** c(n)(nc([o-])=o)=o
 
* inchi-key:
 
* inchi-key:
** okoxeytyhdptew-gjykhrjnsa-j
+
** avwrkzwqtyikiy-uhfffaoysa-m
 
* molecular-weight:
 
* molecular-weight:
** 1106.066
+
** 103.057
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-17112]]
+
* [[ALLOPHANATE-HYDROLASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(9z,12z,15z,18z)-tetracosatetraenoyl-coa}}
+
{{#set: common-name=urea-1-carboxylate}}
{{#set: inchi-key=inchikey=okoxeytyhdptew-gjykhrjnsa-j}}
+
{{#set: inchi-key=inchikey=avwrkzwqtyikiy-uhfffaoysa-m}}
{{#set: molecular-weight=1106.066}}
+
{{#set: molecular-weight=103.057}}

Revision as of 14:20, 26 August 2019

Metabolite CPD-578

  • common-name:
    • urea-1-carboxylate
  • smiles:
    • c(n)(nc([o-])=o)=o
  • inchi-key:
    • avwrkzwqtyikiy-uhfffaoysa-m
  • molecular-weight:
    • 103.057

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality