Difference between revisions of "SJ21399"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite UDP-GLUCURONATE == * common-name: ** udp-α-d-glucuronate * smiles: ** c(c1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2)))op(=o)([o-])op(=o)([o-...")
(Created page with "Category:gene == Gene SJ21399 == * transcription-direction: ** positive * right-end-position: ** 177917 * left-end-position: ** 167320 * centisome-position: ** 86.42562...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite UDP-GLUCURONATE ==
+
== Gene SJ21399 ==
* common-name:
+
* transcription-direction:
** udp-α-d-glucuronate
+
** positive
* smiles:
+
* right-end-position:
** c(c1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2)))op(=o)([o-])op(=o)([o-])oc3(oc(c([o-])=o)c(o)c(o)c(o)3)
+
** 177917
* inchi-key:
+
* left-end-position:
** hdyanyhvcapmjv-lxqifkjmsa-k
+
** 167320
* molecular-weight:
+
* centisome-position:
** 577.265
+
** 86.42562   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
* [[S.japonica_carotenoid_curated]]
* [[2.4.1.212-RXN]]
+
== Reaction(s) associated ==
* [[2.4.1.225-RXN]]
+
* [[ATPASE-RXN]]
* [[2.7.7.44-RXN]]
+
** Category: [[annotation]]
* [[RXN-10606]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
* [[RXN-10607]]
+
* [[NUCLEOSIDE-TRIPHOSPHATASE-RXN]]
* [[RXN-10608]]
+
** Category: [[annotation]]
* [[RXN-10609]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
* [[RXN-10616]]
+
* [[RXN-12195]]
* [[RXN-10617]]
+
** Category: [[annotation]]
* [[RXN-10618]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
* [[RXN-10619]]
+
* [[RXN-12196]]
* [[RXN-10784]]
+
** Category: [[annotation]]
* [[RXN-11060]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
* [[RXN-13607]]
+
* [[RXN0-5462]]
* [[RXN-13608]]
+
** Category: [[annotation]]
* [[RXN-14361]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
* [[RXN-9000]]
+
== Pathway(s) associated ==
* [[RXN66-162]]
+
* [[PWY-6545]]
* [[RXN66-168]]
+
** '''8''' reactions found over '''9''' reactions in the full pathway
* [[RXN66-83]]
+
* [[PWY-7210]]
* [[UDP-GLUCURONATE-4-EPIMERASE-RXN]]
+
** '''8''' reactions found over '''8''' reactions in the full pathway
* [[UDP-GLUCURONATE-DECARBOXYLASE-RXN]]
+
* [[PWY-7198]]
* [[UDP-GLUCURONOSYLTRANSFERASE-RXN]]
+
** '''6''' reactions found over '''7''' reactions in the full pathway
* [[UGDC]]
+
* [[PWY-7184]]
</div>
+
** '''9''' reactions found over '''9''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
{{#set: transcription-direction=positive}}
* [[2.7.7.44-RXN]]
+
{{#set: right-end-position=177917}}
* [[UDP-GLUCURONATE-4-EPIMERASE-RXN]]
+
{{#set: left-end-position=167320}}
* [[UGD-RXN]]
+
{{#set: centisome-position=86.42562    }}
* [[UGDH]]
+
{{#set: organism associated=S.japonica_carotenoid_curated}}
== Reaction(s) of unknown directionality ==
+
{{#set: nb reaction associated=5}}
{{#set: common-name=udp-&alpha;-d-glucuronate}}
+
{{#set: nb pathway associated=4}}
{{#set: inchi-key=inchikey=hdyanyhvcapmjv-lxqifkjmsa-k}}
 
{{#set: molecular-weight=577.265}}
 

Latest revision as of 11:10, 18 March 2021

Gene SJ21399

  • transcription-direction:
    • positive
  • right-end-position:
    • 177917
  • left-end-position:
    • 167320
  • centisome-position:
    • 86.42562

Organism(s) associated with this gene

Reaction(s) associated

Pathway(s) associated

  • PWY-6545
    • 8 reactions found over 9 reactions in the full pathway
  • PWY-7210
    • 8 reactions found over 8 reactions in the full pathway
  • PWY-7198
    • 6 reactions found over 7 reactions in the full pathway
  • PWY-7184
    • 9 reactions found over 9 reactions in the full pathway