Difference between revisions of "SJ21474"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CYTIDINE CYTIDINE] == * common-name: ** cytidine * smiles: ** c(c2(c(c(c(n1(c(n=c(c=c1)n)=o))o2...")
 
(Created page with "Category:gene == Gene SJ21474 == * transcription-direction: ** negative * right-end-position: ** 174516 * left-end-position: ** 169082 * centisome-position: ** 88.11356...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CYTIDINE CYTIDINE] ==
+
== Gene SJ21474 ==
* common-name:
+
* transcription-direction:
** cytidine
+
** negative
* smiles:
+
* right-end-position:
** c(c2(c(c(c(n1(c(n=c(c=c1)n)=o))o2)o)o))o
+
** 174516
* inchi-key:
+
* left-end-position:
** uhdgcwiwmrvcdj-xvfcmesisa-n
+
** 169082
* molecular-weight:
+
* centisome-position:
** 243.219
+
** 88.11356   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[ATCY]]
+
* [[S.japonica_carotenoid_curated]]
* [[ATDTD]]
+
== Reaction(s) associated ==
* [[ATDTDm]]
+
* [[DISULFOXRED-RXN]]
* [[CYTIDEAM2-RXN]]
+
** Category: [[annotation]]
* [[DATCY]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
* [[DCTCP]]
+
* [[PROSTAGLANDIN-E-SYNTHASE-RXN]]
* [[DGTCY]]
+
** Category: [[annotation]]
* [[DTTGY]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
* [[DTTPtm]]
+
== Pathway(s) associated ==
* [[DUTCP]]
+
* [[PWY66-374]]
* [[GTCY]]
+
** '''2''' reactions found over '''7''' reactions in the full pathway
* [[ITCY]]
+
{{#set: transcription-direction=negative}}
* [[RXN0-361]]
+
{{#set: right-end-position=174516}}
* [[UTCY]]
+
{{#set: left-end-position=169082}}
== Reaction(s) known to produce the compound ==
+
{{#set: centisome-position=88.11356    }}
* [[ATDTM]]
+
{{#set: organism associated=S.japonica_carotenoid_curated}}
* [[DTTGY]]
+
{{#set: nb reaction associated=2}}
* [[DTTPtm]]
+
{{#set: nb pathway associated=1}}
* [[DTTUP]]
 
* [[RXN-14026]]
 
== Reaction(s) of unknown directionality ==
 
{{#set: common-name=cytidine}}
 
{{#set: inchi-key=inchikey=uhdgcwiwmrvcdj-xvfcmesisa-n}}
 
{{#set: molecular-weight=243.219}}
 

Latest revision as of 11:01, 18 March 2021

Gene SJ21474

  • transcription-direction:
    • negative
  • right-end-position:
    • 174516
  • left-end-position:
    • 169082
  • centisome-position:
    • 88.11356

Organism(s) associated with this gene

Reaction(s) associated

Pathway(s) associated

  • PWY66-374
    • 2 reactions found over 7 reactions in the full pathway