Difference between revisions of "SJ21480"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18539 CPD-18539] == * common-name: ** (r)-n-formyl-β-hydroxy-l-kynurenine * smiles: **...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DITP DITP] == * common-name: ** ditp * smiles: ** c(op(=o)([o-])op(=o)([o-])op(=o)([o-])[o-])c1...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DITP DITP] == |
* common-name: | * common-name: | ||
| − | ** | + | ** ditp |
* smiles: | * smiles: | ||
| − | ** [ | + | ** c(op(=o)([o-])op(=o)([o-])op(=o)([o-])[o-])c1(oc(cc(o)1)n3(c=nc2(c(=o)nc=nc=23))) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** ufjpaqslhagebl-rrkcrqdmsa-j |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 488.137 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-14228]] |
| + | * [[RXN0-1602]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-14228]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=ditp}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ufjpaqslhagebl-rrkcrqdmsa-j}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=488.137}} |
Revision as of 14:20, 26 August 2019
Contents
Metabolite DITP
- common-name:
- ditp
- smiles:
- c(op(=o)([o-])op(=o)([o-])op(=o)([o-])[o-])c1(oc(cc(o)1)n3(c=nc2(c(=o)nc=nc=23)))
- inchi-key:
- ufjpaqslhagebl-rrkcrqdmsa-j
- molecular-weight:
- 488.137
