Difference between revisions of "SJ21563"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DELTA1-PIPERIDEINE-2-6-DICARBOXYLATE DELTA1-PIPERIDEINE-2-6-DICARBOXYLATE] == * common-name: **...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7285 CPD-7285] == * common-name: ** 25-hydroxycholesterol * smiles: ** cc(cccc(o)(c)c)[ch]3...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DELTA1-PIPERIDEINE-2-6-DICARBOXYLATE DELTA1-PIPERIDEINE-2-6-DICARBOXYLATE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7285 CPD-7285] ==
 
* common-name:
 
* common-name:
** (s)-2,3,4,5-tetrahydrodipicolinate
+
** 25-hydroxycholesterol
 
* smiles:
 
* smiles:
** c1(cc(=nc(c1)c([o-])=o)c([o-])=o)
+
** cc(cccc(o)(c)c)[ch]3(cc[ch]4([ch]2(cc=c1(cc(o)ccc(c)1[ch]2ccc(c)34))))
 
* inchi-key:
 
* inchi-key:
** cxmbcxqhoxuceo-bypyzucnsa-l
+
** inbgsxnnrgwlju-zhhjotbysa-n
 
* molecular-weight:
 
* molecular-weight:
** 169.137
+
** 402.659
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14246]]
 
* [[RXN-7737]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-14014]]
+
* [[1.14.99.38-RXN]]
* [[RXN-14246]]
 
* [[RXN-7737]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(s)-2,3,4,5-tetrahydrodipicolinate}}
+
{{#set: common-name=25-hydroxycholesterol}}
{{#set: inchi-key=inchikey=cxmbcxqhoxuceo-bypyzucnsa-l}}
+
{{#set: inchi-key=inchikey=inbgsxnnrgwlju-zhhjotbysa-n}}
{{#set: molecular-weight=169.137}}
+
{{#set: molecular-weight=402.659}}

Revision as of 14:20, 26 August 2019

Metabolite CPD-7285

  • common-name:
    • 25-hydroxycholesterol
  • smiles:
    • cc(cccc(o)(c)c)[ch]3(cc[ch]4([ch]2(cc=c1(cc(o)ccc(c)1[ch]2ccc(c)34))))
  • inchi-key:
    • inbgsxnnrgwlju-zhhjotbysa-n
  • molecular-weight:
    • 402.659

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality