Difference between revisions of "SJ21564"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12676 CPD-12676] == * common-name: ** 5'-chloro-5'-deoxyadenosine * smiles: ** c(c3(c(c(c(n...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ARSENATE ARSENATE] == * common-name: ** arsenate * smiles: ** [as](=o)(o)([o-])[o-] * inchi-key...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12676 CPD-12676] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ARSENATE ARSENATE] ==
 
* common-name:
 
* common-name:
** 5'-chloro-5'-deoxyadenosine
+
** arsenate
 
* smiles:
 
* smiles:
** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))cl
+
** [as](=o)(o)([o-])[o-]
 
* inchi-key:
 
* inchi-key:
** iysnpomtkfzdhz-kqynxxcusa-n
+
** djhgafsjwgloiv-uhfffaoysa-l
 
* molecular-weight:
 
* molecular-weight:
** 285.689
+
** 139.927
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-11715]]
+
* [[RXN-7001]]
 +
* [[RXN-982]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=5'-chloro-5'-deoxyadenosine}}
+
{{#set: common-name=arsenate}}
{{#set: inchi-key=inchikey=iysnpomtkfzdhz-kqynxxcusa-n}}
+
{{#set: inchi-key=inchikey=djhgafsjwgloiv-uhfffaoysa-l}}
{{#set: molecular-weight=285.689}}
+
{{#set: molecular-weight=139.927}}

Revision as of 14:19, 26 August 2019

Metabolite ARSENATE

  • common-name:
    • arsenate
  • smiles:
    • [as](=o)(o)([o-])[o-]
  • inchi-key:
    • djhgafsjwgloiv-uhfffaoysa-l
  • molecular-weight:
    • 139.927

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality