Difference between revisions of "SJ21573"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FADH2 FADH2] == * common-name: ** fadh2 * smiles: ** cc1(=c(c)c=c2(n(c3(nc(nc(=o)c(nc(=c1)2)=3)...")
(Created page with "Category:gene == Gene SJ21573 == * transcription-direction: ** negative * right-end-position: ** 46434 * left-end-position: ** 45115 * centisome-position: ** 7.5800977...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:metabolite]]
+
[[Category:gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FADH2 FADH2] ==
+
== Gene SJ21573 ==
−
* common-name:
+
* transcription-direction:
−
** fadh2
+
** negative
−
* smiles:
+
* right-end-position:
−
** cc1(=c(c)c=c2(n(c3(nc(nc(=o)c(nc(=c1)2)=3)=o))cc(o)c(o)c(o)cop(op([o-])(occ6(c(o)c(o)c(n5(c=nc4(c(n)=nc=nc=45)))o6))=o)([o-])=o))
+
** 46434
−
* inchi-key:
+
* left-end-position:
−
** ypzrhbjkemoyqh-uybvjogssa-l
+
** 45115
−
* molecular-weight:
+
* centisome-position:
−
** 785.556
+
** 7.5800977   
−
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
−
* [[ACOAD1f]]
+
* [[S.japonica_carotenoid_curated]]
−
* [[PPCOAOm]]
+
== Reaction(s) associated ==
−
* [[RXN-14264]]
+
* [[RNA-DIRECTED-DNA-POLYMERASE-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Category: [[annotation]]
−
* [[ACOA120OR]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
* [[ACOA140OR]]
+
{{#set: transcription-direction=negative}}
−
* [[ACOA160OR]]
+
{{#set: right-end-position=46434}}
−
* [[ACOA40OR]]
+
{{#set: left-end-position=45115}}
−
* [[ACOA80OR]]
+
{{#set: centisome-position=7.5800977    }}
−
* [[ACOAD1f]]
+
{{#set: organism associated=S.japonica_carotenoid_curated}}
−
* [[IVCDH]]
+
{{#set: nb reaction associated=1}}
−
* [[MCDH]]
 
−
* [[MCDH_LPAREN_2mb2coa_RPAREN_]]
 
−
* [[PPCOAOm]]
 
−
* [[RXN-14264]]
 
−
* [[SUCDHm]]
 
−
== Reaction(s) of unknown directionality ==
 
−
{{#set: common-name=fadh2}}
 
−
{{#set: inchi-key=inchikey=ypzrhbjkemoyqh-uybvjogssa-l}}
 
−
{{#set: molecular-weight=785.556}}
 

Latest revision as of 11:02, 18 March 2021

Gene SJ21573

  • transcription-direction:
    • negative
  • right-end-position:
    • 46434
  • left-end-position:
    • 45115
  • centisome-position:
    • 7.5800977

Organism(s) associated with this gene

Reaction(s) associated




Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=SJ21573&oldid=132433"