Difference between revisions of "SJ21586"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8076 CPD-8076] == * common-name: ** 1-18:3-2-16:1-monogalactosyldiacylglycerol * smiles: **...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-479 CPD-479] == * common-name: ** 4-(methylsulfanyl)-2-oxobutanoate * smiles: ** csccc(c([o...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8076 CPD-8076] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-479 CPD-479] ==
 
* common-name:
 
* common-name:
** 1-18:3-2-16:1-monogalactosyldiacylglycerol
+
** 4-(methylsulfanyl)-2-oxobutanoate
 
* smiles:
 
* smiles:
** ccc=ccc=ccc=ccccccccc(occ(coc1(oc(c(c(c1o)o)o)co))oc(cccccc=ccccccccc)=o)=o
+
** csccc(c([o-])=o)=o
 
* inchi-key:
 
* inchi-key:
** syspljxkzrpipm-lwnbrhqxsa-n
+
** sxfsqzdsuwackx-uhfffaoysa-m
 
* molecular-weight:
 
* molecular-weight:
** 751.052
+
** 147.168
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-14147]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-8297]]
+
* [[R147-RXN]]
 +
* [[RXN-14147]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1-18:3-2-16:1-monogalactosyldiacylglycerol}}
+
{{#set: common-name=4-(methylsulfanyl)-2-oxobutanoate}}
{{#set: inchi-key=inchikey=syspljxkzrpipm-lwnbrhqxsa-n}}
+
{{#set: inchi-key=inchikey=sxfsqzdsuwackx-uhfffaoysa-m}}
{{#set: molecular-weight=751.052}}
+
{{#set: molecular-weight=147.168}}

Revision as of 14:19, 26 August 2019

Metabolite CPD-479

  • common-name:
    • 4-(methylsulfanyl)-2-oxobutanoate
  • smiles:
    • csccc(c([o-])=o)=o
  • inchi-key:
    • sxfsqzdsuwackx-uhfffaoysa-m
  • molecular-weight:
    • 147.168

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality