Difference between revisions of "SJ21587"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OXALO-SUCCINATE OXALO-SUCCINATE] == * common-name: ** oxalosuccinate * smiles: ** c(c([o-])=o)c...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12253 CPD-12253] == * common-name: ** (r)-2-hydroxybutanoate * smiles: ** ccc(o)c(=o)[o-] *...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OXALO-SUCCINATE OXALO-SUCCINATE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12253 CPD-12253] ==
 
* common-name:
 
* common-name:
** oxalosuccinate
+
** (r)-2-hydroxybutanoate
 
* smiles:
 
* smiles:
** c(c([o-])=o)c(c(c(=o)[o-])=o)c([o-])=o
+
** ccc(o)c(=o)[o-]
 
* inchi-key:
 
* inchi-key:
** ufscuaxltrfidc-uhfffaoysa-k
+
** afendnxgafykqo-gsvougtgsa-m
 
* molecular-weight:
 
* molecular-weight:
** 187.085
+
** 103.097
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-8642]]
+
* [[RXN-13719]]
* [[RXN-9951]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-8642]]
+
* [[RXN-13719]]
* [[RXN-9951]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=oxalosuccinate}}
+
{{#set: common-name=(r)-2-hydroxybutanoate}}
{{#set: inchi-key=inchikey=ufscuaxltrfidc-uhfffaoysa-k}}
+
{{#set: inchi-key=inchikey=afendnxgafykqo-gsvougtgsa-m}}
{{#set: molecular-weight=187.085}}
+
{{#set: molecular-weight=103.097}}

Revision as of 14:20, 26 August 2019

Metabolite CPD-12253

  • common-name:
    • (r)-2-hydroxybutanoate
  • smiles:
    • ccc(o)c(=o)[o-]
  • inchi-key:
    • afendnxgafykqo-gsvougtgsa-m
  • molecular-weight:
    • 103.097

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality