Difference between revisions of "SJ21593"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-5-ADP 3-5-ADP] == * common-name: ** adenosine 3',5'-bisphosphate * smiles: ** c(c3(c(c(c(n2(c...")
(Created page with "Category:gene == Gene SJ02625 == * transcription-direction: ** positive * right-end-position: ** 252342 * left-end-position: ** 233899 * centisome-position: ** 43.728104...")
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-5-ADP 3-5-ADP] ==
+
== Gene SJ02625 ==
* common-name:
+
* transcription-direction:
** adenosine 3',5'-bisphosphate
+
** positive
* smiles:
+
* right-end-position:
** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)op(=o)([o-])[o-]))op([o-])([o-])=o
+
** 252342
* inchi-key:
+
* left-end-position:
** whtcpdaxwfldih-kqynxxcusa-j
+
** 233899
* molecular-weight:
+
* centisome-position:
** 423.172
+
** 43.728104   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[1.8.4.8-RXN]]
+
* [[S.japonica_sterols_curated]]
* [[325-BISPHOSPHATE-NUCLEOTIDASE-RXN]]
+
== Reaction(s) associated ==
* [[ARYLAMINE-SULFOTRANSFERASE-RXN]]
+
* [[RXN-12461]]
* [[PAPSPAPthr]]
+
** Category: [[annotation]]
* [[RXN-10994]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
* [[RXN-15587]]
+
== Pathway(s) associated ==
* [[RXN-15588]]
+
* [[PWY-7888]]
* [[RXN-15589]]
+
** '''2''' reactions found over '''7''' reactions in the full pathway
* [[RXN-16759]]
+
* [[PWY-6829]]
* [[RXN-17203]]
+
** '''11''' reactions found over '''15''' reactions in the full pathway
* [[RXN-701]]
+
{{#set: transcription-direction=positive}}
== Reaction(s) known to produce the compound ==
+
{{#set: right-end-position=252342}}
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
{{#set: left-end-position=233899}}
* [[1.8.4.8-RXN]]
+
{{#set: centisome-position=43.728104    }}
* [[2.8.2.23-RXN]]
+
{{#set: organism associated=S.japonica_sterols_curated}}
* [[2.8.2.29-RXN]]
+
{{#set: nb reaction associated=1}}
* [[2.8.2.30-RXN]]
+
{{#set: nb pathway associated=2}}
* [[ARYL-SULFOTRANSFERASE-RXN]]
 
* [[ARYLAMINE-SULFOTRANSFERASE-RXN]]
 
* [[CHONDROITIN-4-SULFOTRANSFERASE-RXN]]
 
* [[ENTDB-RXN]]
 
* [[GALACTOSYLCERAMIDE-SULFOTRANSFERASE-RXN]]
 
* [[HEPARITIN-SULFOTRANSFERASE-RXN]]
 
* [[HOLO-ACP-SYNTH-RXN]]
 
* [[PAPSPAPthr]]
 
* [[RXN-10614]]
 
* [[RXN-10615]]
 
* [[RXN-10777]]
 
* [[RXN-10782]]
 
* [[RXN-10994]]
 
* [[RXN-11058]]
 
* [[RXN-11059]]
 
* [[RXN-11555]]
 
* [[RXN-15587]]
 
* [[RXN-15588]]
 
* [[RXN-15589]]
 
* [[RXN-15889]]
 
* [[RXN-16759]]
 
* [[RXN-17203]]
 
* [[RXN-18301]]
 
* [[RXN-18303]]
 
* [[RXN-701]]
 
* [[RXN-7953]]
 
* [[RXN-7954]]
 
* [[RXN6666-9]]
 
</div>
 
== Reaction(s) of unknown directionality ==
 
{{#set: common-name=adenosine 3',5'-bisphosphate}}
 
{{#set: inchi-key=inchikey=whtcpdaxwfldih-kqynxxcusa-j}}
 
{{#set: molecular-weight=423.172}}
 

Revision as of 20:21, 18 December 2020

Gene SJ02625

  • transcription-direction:
    • positive
  • right-end-position:
    • 252342
  • left-end-position:
    • 233899
  • centisome-position:
    • 43.728104

Organism(s) associated with this gene

Reaction(s) associated

Pathway(s) associated

  • PWY-7888
    • 2 reactions found over 7 reactions in the full pathway
  • PWY-6829
    • 11 reactions found over 15 reactions in the full pathway