Difference between revisions of "SJ21602"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-596 CPD-596] == * common-name: ** n6,n6-dimethyl-l-arginine * smiles: ** cn(c(=[n+])ncccc([...")
(Created page with "Category:gene == Gene SJ03554 == * transcription-direction: ** positive * right-end-position: ** 31339 * left-end-position: ** 1656 * centisome-position: ** 1.3874924...")
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-596 CPD-596] ==
+
== Gene SJ03554 ==
* common-name:
+
* transcription-direction:
** n6,n6-dimethyl-l-arginine
+
** positive
* smiles:
+
* right-end-position:
** cn(c(=[n+])ncccc([n+])c(=o)[o-])c
+
** 31339
* inchi-key:
+
* left-end-position:
** ydgmgexadbmomj-lurjtmiesa-o
+
** 1656
* molecular-weight:
+
* centisome-position:
** 203.264
+
** 1.3874924   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[DIMETHYLARGININASE-RXN]]
+
* [[S.japonica_sterols_curated]]
== Reaction(s) known to produce the compound ==
+
== Reaction(s) associated ==
== Reaction(s) of unknown directionality ==
+
* [[2.7.10.1-RXN]]
{{#set: common-name=n6,n6-dimethyl-l-arginine}}
+
** Category: [[annotation]]
{{#set: inchi-key=inchikey=ydgmgexadbmomj-lurjtmiesa-o}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
{{#set: molecular-weight=203.264}}
+
* [[2.7.11.25-RXN]]
 +
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
* [[2.7.12.1-RXN]]
 +
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
* [[PROTEIN-KINASE-RXN]]
 +
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
* [[RXN-14906]]
 +
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
* [[RXN-8443]]
 +
** Category: [[orthology]]
 +
*** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
 +
== Pathway(s) associated ==
 +
* [[PWY-5381]]
 +
** '''6''' reactions found over '''11''' reactions in the full pathway
 +
{{#set: transcription-direction=positive}}
 +
{{#set: right-end-position=31339}}
 +
{{#set: left-end-position=1656}}
 +
{{#set: centisome-position=1.3874924    }}
 +
{{#set: organism associated=S.japonica_sterols_curated}}
 +
{{#set: nb reaction associated=6}}
 +
{{#set: nb pathway associated=1}}

Revision as of 20:22, 18 December 2020

Gene SJ03554

  • transcription-direction:
    • positive
  • right-end-position:
    • 31339
  • left-end-position:
    • 1656
  • centisome-position:
    • 1.3874924

Organism(s) associated with this gene

Reaction(s) associated

Pathway(s) associated

  • PWY-5381
    • 6 reactions found over 11 reactions in the full pathway