Difference between revisions of "SJ21618"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=tRNA-Containing-5MeAminoMe-2-ThioU tRNA-Containing-5MeAminoMe-2-ThioU] == * common-name: ** a 5...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-IDONATE L-IDONATE] == * common-name: ** l-idonate * smiles: ** c(o)c(o)c(o)c(o)c(o)c(=o)[o-]...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=tRNA-Containing-5MeAminoMe-2-ThioU tRNA-Containing-5MeAminoMe-2-ThioU] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-IDONATE L-IDONATE] ==
 
* common-name:
 
* common-name:
** a 5-methylaminomethyl-2-thiouridine34 in trna
+
** l-idonate
 +
* smiles:
 +
** c(o)c(o)c(o)c(o)c(o)c(=o)[o-]
 +
* inchi-key:
 +
** rghnjxzeokukbd-sknvomklsa-m
 +
* molecular-weight:
 +
** 195.149
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-12107]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN0-5144]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a 5-methylaminomethyl-2-thiouridine34 in trna}}
+
{{#set: common-name=l-idonate}}
 +
{{#set: inchi-key=inchikey=rghnjxzeokukbd-sknvomklsa-m}}
 +
{{#set: molecular-weight=195.149}}

Revision as of 09:24, 27 August 2019

Metabolite L-IDONATE

  • common-name:
    • l-idonate
  • smiles:
    • c(o)c(o)c(o)c(o)c(o)c(=o)[o-]
  • inchi-key:
    • rghnjxzeokukbd-sknvomklsa-m
  • molecular-weight:
    • 195.149

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality