Difference between revisions of "SJ21660"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SUC-COA SUC-COA] == * common-name: ** succinyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=23-DIPHOSPHOGLYCERATE 23-DIPHOSPHOGLYCERATE] == * common-name: ** 2,3-diphospho-d-glycerate * s...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SUC-COA SUC-COA] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=23-DIPHOSPHOGLYCERATE 23-DIPHOSPHOGLYCERATE] ==
 
* common-name:
 
* common-name:
** succinyl-coa
+
** 2,3-diphospho-d-glycerate
 
* smiles:
 
* smiles:
** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)ccc(=o)[o-])cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])c(=o)[o-]
 
* inchi-key:
 
* inchi-key:
** vnoyujkhfwywir-itiydsspsa-i
+
** xohueycvluuejj-uwtatzphsa-i
 
* molecular-weight:
 
* molecular-weight:
** 862.568
+
** 260.998
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[AKGDHe2r]]
+
* [[RXN-15509]]
* [[HOMSUCTRAN-RXN]]
+
* [[RXN-15510]]
* [[RXN0-1147]]
+
* [[RXN-15511]]
* [[SUCCCOASYN-RXN]]
+
* [[RXN-15512]]
* [[SUCCINATE--COA-LIGASE-GDP-FORMING-RXN]]
 
* [[SUCL_LPAREN_gdp_RPAREN_m]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2OXOGLUTARATEDEH-RXN]]
+
* [[BISPHOSPHOGLYCERATE-MUTASE-RXN]]
* [[AKGDHe2r]]
+
* [[RXN-15509]]
* [[RXN0-1147]]
+
* [[RXN-15510]]
* [[SUCCCOASYN-RXN]]
+
* [[RXN-15511]]
* [[SUCCINATE--COA-LIGASE-GDP-FORMING-RXN]]
+
* [[RXN-15512]]
* [[SUCL_LPAREN_gdp_RPAREN_m]]
+
* [[RXN-17276]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=succinyl-coa}}
+
{{#set: common-name=2,3-diphospho-d-glycerate}}
{{#set: inchi-key=inchikey=vnoyujkhfwywir-itiydsspsa-i}}
+
{{#set: inchi-key=inchikey=xohueycvluuejj-uwtatzphsa-i}}
{{#set: molecular-weight=862.568}}
+
{{#set: molecular-weight=260.998}}

Revision as of 09:25, 27 August 2019

Metabolite 23-DIPHOSPHOGLYCERATE

  • common-name:
    • 2,3-diphospho-d-glycerate
  • smiles:
    • c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])c(=o)[o-]
  • inchi-key:
    • xohueycvluuejj-uwtatzphsa-i
  • molecular-weight:
    • 260.998

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality