Difference between revisions of "SJ21660"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=23-DIPHOSPHOGLYCERATE 23-DIPHOSPHOGLYCERATE] == * common-name: ** 2,3-diphospho-d-glycerate * s...")
(Created page with "Category:gene == Gene SJ21284 == == Organism(s) associated with this gene == * S.japonica_sterols_curated == Reaction(s) associated == * 4.2.2.10-RXN ** Category:...")
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=23-DIPHOSPHOGLYCERATE 23-DIPHOSPHOGLYCERATE] ==
+
== Gene SJ21284 ==
* common-name:
+
== Organism(s) associated with this gene  ==
** 2,3-diphospho-d-glycerate
+
* [[S.japonica_sterols_curated]]
* smiles:
+
== Reaction(s) associated ==
** c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])c(=o)[o-]
+
* [[4.2.2.10-RXN]]
* inchi-key:
+
** Category: [[orthology]]
** xohueycvluuejj-uwtatzphsa-i
+
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
* molecular-weight:
+
* [[RXN-14897]]
** 260.998
+
** Category: [[orthology]]
== Reaction(s) known to consume the compound ==
+
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
* [[RXN-15509]]
+
== Pathway(s) associated ==
* [[RXN-15510]]
+
* [[PWY-7243]]
* [[RXN-15511]]
+
** '''1''' reactions found over '''n.a''' reactions in the full pathway
* [[RXN-15512]]
+
{{#set: organism associated=S.japonica_sterols_curated}}
== Reaction(s) known to produce the compound ==
+
{{#set: nb reaction associated=2}}
* [[BISPHOSPHOGLYCERATE-MUTASE-RXN]]
+
{{#set: nb pathway associated=1}}
* [[RXN-15509]]
 
* [[RXN-15510]]
 
* [[RXN-15511]]
 
* [[RXN-15512]]
 
* [[RXN-17276]]
 
== Reaction(s) of unknown directionality ==
 
{{#set: common-name=2,3-diphospho-d-glycerate}}
 
{{#set: inchi-key=inchikey=xohueycvluuejj-uwtatzphsa-i}}
 
{{#set: molecular-weight=260.998}}
 

Revision as of 20:22, 18 December 2020

Gene SJ21284

Organism(s) associated with this gene

Reaction(s) associated

Pathway(s) associated

  • PWY-7243
    • 1 reactions found over n.a reactions in the full pathway