Difference between revisions of "SJ21688"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-METHYL-CROTONYL-COA 3-METHYL-CROTONYL-COA] == * common-name: ** 3-methylcrotonyl-coa * smiles...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MAPKK-Ser-or-Thr-phosphate MAPKK-Ser-or-Thr-phosphate] == * common-name: ** a [map kinase kinas...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-METHYL-CROTONYL-COA 3-METHYL-CROTONYL-COA] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MAPKK-Ser-or-Thr-phosphate MAPKK-Ser-or-Thr-phosphate] ==
 
* common-name:
 
* common-name:
** 3-methylcrotonyl-coa
+
** a [map kinase kinase] (l-serine/l-threonine) phosphate
* smiles:
 
** cc(=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])c
 
* inchi-key:
 
** bxipalatiynhjn-zmhdxicwsa-j
 
* molecular-weight:
 
** 845.604
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ECH_LPAREN_3hivcoa_RPAREN_]]
+
* [[2.7.11.25-RXN]]
* [[METHYLCROTONYL-COA-CARBOXYLASE-RXN]]
 
* [[RXN-14264]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ECH_LPAREN_3hivcoa_RPAREN_]]
+
* [[2.7.11.25-RXN]]
* [[IVCDH]]
 
* [[RXN-11921]]
 
* [[RXN-14264]]
 
* [[RXN0-2301]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-methylcrotonyl-coa}}
+
{{#set: common-name=a [map kinase kinase] (l-serine/l-threonine) phosphate}}
{{#set: inchi-key=inchikey=bxipalatiynhjn-zmhdxicwsa-j}}
 
{{#set: molecular-weight=845.604}}
 

Revision as of 14:19, 26 August 2019

Metabolite MAPKK-Ser-or-Thr-phosphate

  • common-name:
    • a [map kinase kinase] (l-serine/l-threonine) phosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [map kinase kinase] (l-serine/l-threonine) phosphate" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.