Difference between revisions of "SJ21703"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19179 CPD-19179] == * common-name: ** (8s)-3',8-cyclo-7,8-dihydroguanosine 5'-triphosphate...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=XTP XTP] == * common-name: ** xtp * smiles: ** c(op(=o)([o-])op(=o)([o-])op(=o)([o-])[o-])c1(oc...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19179 CPD-19179] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=XTP XTP] ==
 
* common-name:
 
* common-name:
** (8s)-3',8-cyclo-7,8-dihydroguanosine 5'-triphosphate
+
** xtp
 
* smiles:
 
* smiles:
** c(op(=o)([o-])op(=o)([o-])op(=o)([o-])[o-])c3(oc2(n1(c4(n=c(n)nc(=o)c(n[ch]1c(o)(c(o)2)3)=4))))
+
** c(op(=o)([o-])op(=o)([o-])op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc(=o)nc=23)))
 
* inchi-key:
 
* inchi-key:
** hrbcpxbjawppic-gzbygqqwsa-j
+
** caefewvyezabla-uuokfmhzsa-j
 
* molecular-weight:
 
* molecular-weight:
** 519.151
+
** 520.136
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-17809]]
+
* [[NTPD]]
 +
* [[RXN0-1603]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-8340]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(8s)-3',8-cyclo-7,8-dihydroguanosine 5'-triphosphate}}
+
{{#set: common-name=xtp}}
{{#set: inchi-key=inchikey=hrbcpxbjawppic-gzbygqqwsa-j}}
+
{{#set: inchi-key=inchikey=caefewvyezabla-uuokfmhzsa-j}}
{{#set: molecular-weight=519.151}}
+
{{#set: molecular-weight=520.136}}

Revision as of 09:24, 27 August 2019

Metabolite XTP

  • common-name:
    • xtp
  • smiles:
    • c(op(=o)([o-])op(=o)([o-])op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc(=o)nc=23)))
  • inchi-key:
    • caefewvyezabla-uuokfmhzsa-j
  • molecular-weight:
    • 520.136

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality