Difference between revisions of "SJ21718"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-316 CPD-316] == * common-name: ** reduced riboflavin * smiles: ** cc1(=c(c=c2(c(=c1)nc3(c(n...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-arginyl-3-sulfo-L-alaninyl-Peptides L-arginyl-3-sulfo-L-alaninyl-Peptides] == * common-name:...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-316 CPD-316] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-arginyl-3-sulfo-L-alaninyl-Peptides L-arginyl-3-sulfo-L-alaninyl-Peptides] ==
 
* common-name:
 
* common-name:
** reduced riboflavin
+
** an n-terminal l-arginiyl-3-sulfo-l-alanyl-[protein]
* smiles:
 
** cc1(=c(c=c2(c(=c1)nc3(c(n2cc(o)c(o)c(o)co)=nc(nc3=o)=o)))c)
 
* inchi-key:
 
** utkdoucgqvljin-pigzvrmjsa-n
 
* molecular-weight:
 
** 378.384
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[NADPH-DEHYDROGENASE-FLAVIN-RXN]]
+
* [[RXN-17891]]
* [[RXN-12445]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=reduced riboflavin}}
+
{{#set: common-name=an n-terminal l-arginiyl-3-sulfo-l-alanyl-[protein]}}
{{#set: inchi-key=inchikey=utkdoucgqvljin-pigzvrmjsa-n}}
 
{{#set: molecular-weight=378.384}}
 

Revision as of 09:24, 27 August 2019

Metabolite L-arginyl-3-sulfo-L-alaninyl-Peptides

  • common-name:
    • an n-terminal l-arginiyl-3-sulfo-l-alanyl-[protein]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "an n-terminal l-arginiyl-3-sulfo-l-alanyl-[protein" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.