Difference between revisions of "SJ21974"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8088 CPD-8088] == * common-name: ** 1-linoleoyl-2-oleoyl-phosphatidylcholine * smiles: ** c...")
(Created page with "Category:gene == Gene SJ21974 == * transcription-direction: ** positive * right-end-position: ** 286497 * left-end-position: ** 263237 * centisome-position: ** 44.83973...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8088 CPD-8088] ==
+
== Gene SJ21974 ==
* common-name:
+
* transcription-direction:
** 1-linoleoyl-2-oleoyl-phosphatidylcholine
+
** positive
* smiles:
+
* right-end-position:
** cccccc=ccc=ccccccccc(occ(oc(=o)cccccccc=ccccccccc)cop([o-])(=o)occ[n+](c)(c)c)=o
+
** 286497
* inchi-key:
+
* left-end-position:
** rtazwrzkfstmoy-nmsvecgzsa-n
+
** 263237
* molecular-weight:
+
* centisome-position:
** 784.107
+
** 44.83973   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[RXN-8321]]
+
* [[S.japonica_carotenoid_curated]]
* [[RXN-8328]]
+
== Reaction(s) associated ==
== Reaction(s) known to produce the compound ==
+
* [[3.1.3.16-RXN]]
* [[RXN-8320]]
+
** Category: [[annotation]]
== Reaction(s) of unknown directionality ==
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
{{#set: common-name=1-linoleoyl-2-oleoyl-phosphatidylcholine}}
+
* [[4-NITROPHENYLPHOSPHATASE-RXN]]
{{#set: inchi-key=inchikey=rtazwrzkfstmoy-nmsvecgzsa-n}}
+
** Category: [[annotation]]
{{#set: molecular-weight=784.107}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
{{#set: transcription-direction=positive}}
 +
{{#set: right-end-position=286497}}
 +
{{#set: left-end-position=263237}}
 +
{{#set: centisome-position=44.83973    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=2}}

Latest revision as of 11:03, 18 March 2021

Gene SJ21974

  • transcription-direction:
    • positive
  • right-end-position:
    • 286497
  • left-end-position:
    • 263237
  • centisome-position:
    • 44.83973

Organism(s) associated with this gene

Reaction(s) associated