Difference between revisions of "SJ22060"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-KETO-ADIPYL-COA 3-KETO-ADIPYL-COA] == * common-name: ** 3-oxoadipyl-coa * smiles: ** cc(c)(c(...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HIS HIS] == * common-name: ** l-histidine * smiles: ** c1(nc=nc=1cc(c(=o)[o-])[n+]) * inchi-key...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-KETO-ADIPYL-COA 3-KETO-ADIPYL-COA] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HIS HIS] ==
 
* common-name:
 
* common-name:
** 3-oxoadipyl-coa
+
** l-histidine
 
* smiles:
 
* smiles:
** cc(c)(c(o)c(=o)nccc(=o)nccsc(cc(ccc([o-])=o)=o)=o)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** c1(nc=nc=1cc(c(=o)[o-])[n+])
 
* inchi-key:
 
* inchi-key:
** vkkkaapgxhwxoo-biewrjsysa-i
+
** hndvdqjcigzpno-yfkpbyrvsa-n
 
* molecular-weight:
 
* molecular-weight:
** 904.605
+
** 155.156
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN0-2044]]
+
* [[HISTIDINE--TRNA-LIGASE-RXN]]
 +
* [[HISTIDINE-AMMONIA-LYASE-RXN]]
 +
* [[HISTIDINE-DECARBOXYLASE-RXN]]
 +
* [[biomass_rxn]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN0-2044]]
+
* [[HISTALDEHYD-RXN]]
 +
* [[RXN-8001]]
 +
* [[RXN0-6978]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-oxoadipyl-coa}}
+
{{#set: common-name=l-histidine}}
{{#set: inchi-key=inchikey=vkkkaapgxhwxoo-biewrjsysa-i}}
+
{{#set: inchi-key=inchikey=hndvdqjcigzpno-yfkpbyrvsa-n}}
{{#set: molecular-weight=904.605}}
+
{{#set: molecular-weight=155.156}}

Revision as of 14:20, 26 August 2019

Metabolite HIS

  • common-name:
    • l-histidine
  • smiles:
    • c1(nc=nc=1cc(c(=o)[o-])[n+])
  • inchi-key:
    • hndvdqjcigzpno-yfkpbyrvsa-n
  • molecular-weight:
    • 155.156

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality