Difference between revisions of "SJ22113"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Linoleoyl-groups Linoleoyl-groups] == * common-name: ** a [glycerolipid]-linoleate == Reaction(...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FRUCTOSE-6P FRUCTOSE-6P] == * common-name: ** β-d-fructofuranose 6-phosphate * smiles: **...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Linoleoyl-groups Linoleoyl-groups] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FRUCTOSE-6P FRUCTOSE-6P] ==
 
* common-name:
 
* common-name:
** a [glycerolipid]-linoleate
+
** β-d-fructofuranose 6-phosphate
 +
* smiles:
 +
** c(op(=o)([o-])[o-])c1(oc(co)(o)c(o)c(o)1)
 +
* inchi-key:
 +
** bgwgxpapygqalx-arqdhwqxsa-l
 +
* molecular-weight:
 +
** 258.121
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[1.14.99.33-RXN]]
+
* [[2.7.1.90-RXN]]
* [[RXN-11680]]
+
* [[2TRANSKETO-RXN]]
* [[RXN-16045]]
+
* [[6-PHOSPHOFRUCTO-2-KINASE-RXN]]
* [[RXN-16046]]
+
* [[6PFRUCTPHOS-RXN]]
* [[RXN-9667]]
+
* [[L-GLN-FRUCT-6-P-AMINOTRANS-RXN]]
 +
* [[MANNPDEHYDROG-RXN]]
 +
* [[MANNPISOM-RXN]]
 +
* [[MANNPISOM-RXN-MANNOSE-6P//FRUCTOSE-6P.24.]]
 +
* [[PFK_]]
 +
* [[PGIA]]
 +
* [[PGIAh]]
 +
* [[PGIB]]
 +
* [[PGIBh]]
 +
* [[PGLUCISOM-RXN]]
 +
* [[RXN-14812]]
 +
* [[TRANSALDOL-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-9669]]
+
* [[2.7.1.90-RXN]]
 +
* [[2TRANSKETO-RXN]]
 +
* [[3.1.3.46-RXN]]
 +
* [[F16BDEPHOS-RXN]]
 +
* [[FRUCTOKINASE-RXN]]
 +
* [[L-GLN-FRUCT-6-P-AMINOTRANS-RXN]]
 +
* [[MANNPDEHYDROG-RXN]]
 +
* [[MANNPISOM-RXN]]
 +
* [[MANNPISOM-RXN-MANNOSE-6P//FRUCTOSE-6P.24.]]
 +
* [[PGIA]]
 +
* [[PGIAh]]
 +
* [[PGIB]]
 +
* [[PGIBh]]
 +
* [[PGLUCISOM-RXN]]
 +
* [[RXN-14812]]
 +
* [[TRANSALDOL-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a [glycerolipid]-linoleate}}
+
{{#set: common-name=β-d-fructofuranose 6-phosphate}}
 +
{{#set: inchi-key=inchikey=bgwgxpapygqalx-arqdhwqxsa-l}}
 +
{{#set: molecular-weight=258.121}}

Revision as of 14:19, 26 August 2019