Difference between revisions of "SJ22215"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15382 CPD-15382] == * common-name: ** keto-d-fructose * smiles: ** c(o)c(=o)c(o)c(o)c(o)co...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7222 CPD-7222] == * common-name: ** (2e)-dodec-2-enoyl-coa * smiles: ** cccccccccc=cc(sccnc...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15382 CPD-15382] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7222 CPD-7222] ==
 
* common-name:
 
* common-name:
** keto-d-fructose
+
** (2e)-dodec-2-enoyl-coa
 
* smiles:
 
* smiles:
** c(o)c(=o)c(o)c(o)c(o)co
+
** cccccccccc=cc(sccnc(ccnc(c(c(cop(op(occ3(oc(n2(c1(=c(c(=nc=n1)n)n=c2)))c(c3op([o-])([o-])=o)o))([o-])=o)([o-])=o)(c)c)o)=o)=o)=o
 
* inchi-key:
 
* inchi-key:
** bjhikxhvcxfqls-uyfozjqfsa-n
+
** irfyvbulxzmede-xcfippspsa-j
 
* molecular-weight:
 
* molecular-weight:
** 180.157
+
** 943.792
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[GLUCISOM-RXN]]
+
* [[ECOAH5]]
* [[GLUCISOM-RXN-ALPHA-GLUCOSE//CPD-15382.25.]]
+
* [[ECOAH5h]]
* [[GLUCISOM-RXN-GLC//CPD-15382.15.]]
+
* [[ECOAH5m]]
* [[MANNITOL-2-DEHYDROGENASE-RXN]]
+
* [[RXN-14262]]
* [[RXN-7644]]
+
* [[RXN-7931]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[GLUCISOM-RXN]]
+
* [[ACOA120OR]]
* [[GLUCISOM-RXN-ALPHA-GLUCOSE//CPD-15382.25.]]
+
* [[ECOAH5]]
* [[GLUCISOM-RXN-GLC//CPD-15382.15.]]
+
* [[ECOAH5h]]
* [[MANNITOL-2-DEHYDROGENASE-RXN]]
+
* [[ECOAH5m]]
* [[RXN-7644]]
+
* [[RXN-14262]]
 +
* [[RXN-7931]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=keto-d-fructose}}
+
{{#set: common-name=(2e)-dodec-2-enoyl-coa}}
{{#set: inchi-key=inchikey=bjhikxhvcxfqls-uyfozjqfsa-n}}
+
{{#set: inchi-key=inchikey=irfyvbulxzmede-xcfippspsa-j}}
{{#set: molecular-weight=180.157}}
+
{{#set: molecular-weight=943.792}}

Revision as of 09:23, 27 August 2019

Metabolite CPD-7222

  • common-name:
    • (2e)-dodec-2-enoyl-coa
  • smiles:
    • cccccccccc=cc(sccnc(ccnc(c(c(cop(op(occ3(oc(n2(c1(=c(c(=nc=n1)n)n=c2)))c(c3op([o-])([o-])=o)o))([o-])=o)([o-])=o)(c)c)o)=o)=o)=o
  • inchi-key:
    • irfyvbulxzmede-xcfippspsa-j
  • molecular-weight:
    • 943.792

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality