Difference between revisions of "SJ22218"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2751 CPD-2751] == * common-name: ** 5'-hydroxycotinine * smiles: ** c1(=o)(ccc(o)(n(c)1)c2(...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-ACETYL-9-O-ACETYLNEURAMINATE N-ACETYL-9-O-ACETYLNEURAMINATE] == * common-name: ** n-acetyl-9-...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-ACETYL-9-O-ACETYLNEURAMINATE N-ACETYL-9-O-ACETYLNEURAMINATE] == |
* common-name: | * common-name: | ||
| − | ** | + | ** n-acetyl-9-o-acetylneuraminate |
* smiles: | * smiles: | ||
| − | ** | + | ** cc(nc1(c(cc(o)(c(=o)[o-])oc1c(c(coc(=o)c)o)o)o))=o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** nywzbrwkdrmpas-gyqvtdhrsa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 350.302 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-7864]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-7864]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=n-acetyl-9-o-acetylneuraminate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=nywzbrwkdrmpas-gyqvtdhrsa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=350.302}} |
Revision as of 09:23, 27 August 2019
Contents
Metabolite N-ACETYL-9-O-ACETYLNEURAMINATE
- common-name:
- n-acetyl-9-o-acetylneuraminate
- smiles:
- cc(nc1(c(cc(o)(c(=o)[o-])oc1c(c(coc(=o)c)o)o)o))=o
- inchi-key:
- nywzbrwkdrmpas-gyqvtdhrsa-m
- molecular-weight:
- 350.302
