Difference between revisions of "SJ22218"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BENZOYLSUCCINYL-COA BENZOYLSUCCINYL-COA] == * common-name: ** benzoylsuccinyl-coa * smiles: **...")
 
(Created page with "Category:gene == Gene SJ22218 == * transcription-direction: ** negative * right-end-position: ** 179264 * left-end-position: ** 165936 * centisome-position: ** 92.476425...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BENZOYLSUCCINYL-COA BENZOYLSUCCINYL-COA] ==
+
== Gene SJ22218 ==
* common-name:
+
* transcription-direction:
** benzoylsuccinyl-coa
+
** negative
* smiles:
+
* right-end-position:
** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c(c(=o)c1(=cc=cc=c1))cc(=o)[o-])cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]
+
** 179264
* inchi-key:
+
* left-end-position:
** sgnpjinsckfitg-ihebcorqsa-i
+
** 165936
* molecular-weight:
+
* centisome-position:
** 966.676
+
** 92.476425   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
== Reaction(s) known to produce the compound ==
+
* [[S.japonica_carotenoid_curated]]
* [[RXN-905]]
+
== Reaction(s) associated ==
== Reaction(s) of unknown directionality ==
+
* [[RXN-11837]]
{{#set: common-name=benzoylsuccinyl-coa}}
+
** Category: [[annotation]]
{{#set: inchi-key=inchikey=sgnpjinsckfitg-ihebcorqsa-i}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
{{#set: molecular-weight=966.676}}
+
* [[TRNA-PSEUDOURIDINE-SYNTHASE-I-RXN]]
 +
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
** Category: [[orthology]]
 +
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 +
{{#set: transcription-direction=negative}}
 +
{{#set: right-end-position=179264}}
 +
{{#set: left-end-position=165936}}
 +
{{#set: centisome-position=92.476425    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=2}}

Latest revision as of 11:00, 18 March 2021

Gene SJ22218

  • transcription-direction:
    • negative
  • right-end-position:
    • 179264
  • left-end-position:
    • 165936
  • centisome-position:
    • 92.476425

Organism(s) associated with this gene

Reaction(s) associated