Difference between revisions of "SJ22247"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4211 CPD-4211] == * common-name: ** dimethylallyl diphosphate * smiles: ** cc(c)=ccop(=o)([...")
(Created page with "Category:gene == Gene SJ22247 == * transcription-direction: ** positive * right-end-position: ** 109141 * left-end-position: ** 88134 * centisome-position: ** 49.25035...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4211 CPD-4211] ==
+
== Gene SJ22247 ==
* common-name:
+
* transcription-direction:
** dimethylallyl diphosphate
+
** positive
* smiles:
+
* right-end-position:
** cc(c)=ccop(=o)([o-])op(=o)([o-])[o-]
+
** 109141
* inchi-key:
+
* left-end-position:
** cbidrcwhncksto-uhfffaoysa-k
+
** 88134
* molecular-weight:
+
* centisome-position:
** 243.069
+
** 49.25035   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[GPPS]]
+
* [[S.japonica_carotenoid_curated]]
* [[GPPSYN-RXN]]
+
== Reaction(s) associated ==
* [[IPPISOM-RXN]]
+
* [[RXN-9839]]
* [[RXN-4303]]
+
** Category: [[annotation]]
* [[RXN-4305]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
* [[RXN-4307]]
+
== Pathway(s) associated ==
* [[RXN-7810]]
+
* [[PWY-6082]]
* [[RXN-7811]]
+
** '''3''' reactions found over '''7''' reactions in the full pathway
* [[RXN-7813]]
+
* [[PWY-6073]]
* [[RXN0-6274]]
+
** '''3''' reactions found over '''3''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
{{#set: transcription-direction=positive}}
* [[GPPSYN-RXN]]
+
{{#set: right-end-position=109141}}
* [[IDI]]
+
{{#set: left-end-position=88134}}
* [[IDS2]]
+
{{#set: centisome-position=49.25035    }}
* [[IPPISOM-RXN]]
+
{{#set: organism associated=S.japonica_carotenoid_curated}}
* [[RXN0-884]]
+
{{#set: nb reaction associated=1}}
== Reaction(s) of unknown directionality ==
+
{{#set: nb pathway associated=2}}
{{#set: common-name=dimethylallyl diphosphate}}
 
{{#set: inchi-key=inchikey=cbidrcwhncksto-uhfffaoysa-k}}
 
{{#set: molecular-weight=243.069}}
 

Latest revision as of 11:01, 18 March 2021

Gene SJ22247

  • transcription-direction:
    • positive
  • right-end-position:
    • 109141
  • left-end-position:
    • 88134
  • centisome-position:
    • 49.25035

Organism(s) associated with this gene

Reaction(s) associated

Pathway(s) associated

  • PWY-6082
    • 3 reactions found over 7 reactions in the full pathway
  • PWY-6073
    • 3 reactions found over 3 reactions in the full pathway