Difference between revisions of "SJ22263"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SCOPOLETIN SCOPOLETIN] == * common-name: ** scopoletin * smiles: ** coc2(c=c1(c(oc(=o)c=c1)=cc=...")
 
(Created page with "Category:gene == Gene SJ22263 == * transcription-direction: ** positive * right-end-position: ** 351503 * left-end-position: ** 328434 * centisome-position: ** 56.36639...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SCOPOLETIN SCOPOLETIN] ==
+
== Gene SJ22263 ==
* common-name:
+
* transcription-direction:
** scopoletin
+
** positive
* smiles:
+
* right-end-position:
** coc2(c=c1(c(oc(=o)c=c1)=cc=2o))
+
** 351503
* inchi-key:
+
* left-end-position:
** rodxrvnmmdrfik-uhfffaoysa-n
+
** 328434
* molecular-weight:
+
* centisome-position:
** 192.171
+
** 56.36639   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
== Reaction(s) known to produce the compound ==
+
* [[S.japonica_carotenoid_curated]]
* [[RXN-14179]]
+
== Reaction(s) associated ==
== Reaction(s) of unknown directionality ==
+
* [[3.5.1.98-RXN]]
{{#set: common-name=scopoletin}}
+
** Category: [[annotation]]
{{#set: inchi-key=inchikey=rodxrvnmmdrfik-uhfffaoysa-n}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
{{#set: molecular-weight=192.171}}
+
** Category: [[orthology]]
 +
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 +
{{#set: transcription-direction=positive}}
 +
{{#set: right-end-position=351503}}
 +
{{#set: left-end-position=328434}}
 +
{{#set: centisome-position=56.36639    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=1}}

Latest revision as of 11:01, 18 March 2021

Gene SJ22263

  • transcription-direction:
    • positive
  • right-end-position:
    • 351503
  • left-end-position:
    • 328434
  • centisome-position:
    • 56.36639

Organism(s) associated with this gene

Reaction(s) associated