Difference between revisions of "SJ22265"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite SCOPOLETIN == * common-name: ** scopoletin * smiles: ** coc2(c=c1(c(oc(=o)c=c1)=cc=2o)) * inchi-key: ** rodxrvnmmdrfik-uhfffaoysa-n * mol...") |
(Created page with "Category:gene == Gene SJ22265 == * transcription-direction: ** positive * right-end-position: ** 421755 * left-end-position: ** 419712 * centisome-position: ** 72.03168...") |
||
(6 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:gene]] |
− | == | + | == Gene SJ22265 == |
− | * | + | * transcription-direction: |
− | ** | + | ** positive |
− | * | + | * right-end-position: |
− | ** | + | ** 421755 |
− | * | + | * left-end-position: |
− | ** | + | ** 419712 |
− | * | + | * centisome-position: |
− | ** | + | ** 72.03168 |
− | == | + | == Organism(s) associated with this gene == |
− | == Reaction(s) | + | * [[S.japonica_carotenoid_curated]] |
− | * [[RXN- | + | == Reaction(s) associated == |
− | == | + | * [[RXN-15561]] |
− | {{#set: | + | ** Category: [[annotation]] |
− | {{#set: | + | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a |
− | {{#set: | + | * [[UBIQUITIN--PROTEIN-LIGASE-RXN]] |
+ | ** Category: [[annotation]] | ||
+ | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a | ||
+ | == Pathway(s) associated == | ||
+ | * [[PWY-7511]] | ||
+ | ** '''7''' reactions found over '''9''' reactions in the full pathway | ||
+ | {{#set: transcription-direction=positive}} | ||
+ | {{#set: right-end-position=421755}} | ||
+ | {{#set: left-end-position=419712}} | ||
+ | {{#set: centisome-position=72.03168 }} | ||
+ | {{#set: organism associated=S.japonica_carotenoid_curated}} | ||
+ | {{#set: nb reaction associated=2}} | ||
+ | {{#set: nb pathway associated=1}} |
Latest revision as of 11:10, 18 March 2021
Contents
Gene SJ22265
- transcription-direction:
- positive
- right-end-position:
- 421755
- left-end-position:
- 419712
- centisome-position:
- 72.03168
Organism(s) associated with this gene
Reaction(s) associated
- RXN-15561
- Category: annotation
- source: saccharina_japonica_genome; tool: pathwaytools; comment: n.a
- Category: annotation
- UBIQUITIN--PROTEIN-LIGASE-RXN
- Category: annotation
- source: saccharina_japonica_genome; tool: pathwaytools; comment: n.a
- Category: annotation
Pathway(s) associated
- PWY-7511
- 7 reactions found over 9 reactions in the full pathway