Difference between revisions of "SJ22265"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ12257 == * transcription-direction: ** positive * right-end-position: ** 120912 * left-end-position: ** 92318 * centisome-position: ** 25.634775...")
(Created page with "Category:metabolite == Metabolite SCOPOLETIN == * common-name: ** scopoletin * smiles: ** coc2(c=c1(c(oc(=o)c=c1)=cc=2o)) * inchi-key: ** rodxrvnmmdrfik-uhfffaoysa-n * mol...")
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ12257 ==
+
== Metabolite SCOPOLETIN ==
* transcription-direction:
+
* common-name:
** positive
+
** scopoletin
* right-end-position:
+
* smiles:
** 120912
+
** coc2(c=c1(c(oc(=o)c=c1)=cc=2o))
* left-end-position:
+
* inchi-key:
** 92318
+
** rodxrvnmmdrfik-uhfffaoysa-n
* centisome-position:
+
* molecular-weight:
** 25.634775   
+
** 192.171
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
== Reaction(s) known to produce the compound ==
== Reaction(s) associated ==
+
* [[RXN-14179]]
* [[GALACTURIDYLYLTRANS-RXN]]
+
== Reaction(s) of unknown directionality ==
** Category: [[orthology]]
+
{{#set: common-name=scopoletin}}
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
{{#set: inchi-key=inchikey=rodxrvnmmdrfik-uhfffaoysa-n}}
* [[RNA-URIDYLYLTRANSFERASE-RXN]]
+
{{#set: molecular-weight=192.171}}
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
== Pathway(s) associated ==
 
* [[PWY-6527]]
 
** '''7''' reactions found over '''7''' reactions in the full pathway
 
* [[PWY-6317]]
 
** '''5''' reactions found over '''5''' reactions in the full pathway
 
* [[PWY66-422]]
 
** '''5''' reactions found over '''5''' reactions in the full pathway
 
{{#set: transcription-direction=positive}}
 
{{#set: right-end-position=120912}}
 
{{#set: left-end-position=92318}}
 
{{#set: centisome-position=25.634775    }}
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=2}}
 
{{#set: nb pathway associated=3}}
 

Revision as of 20:29, 18 December 2020

Metabolite SCOPOLETIN

  • common-name:
    • scopoletin
  • smiles:
    • coc2(c=c1(c(oc(=o)c=c1)=cc=2o))
  • inchi-key:
    • rodxrvnmmdrfik-uhfffaoysa-n
  • molecular-weight:
    • 192.171

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality