Difference between revisions of "SJ22334"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=METHYLARSONATE METHYLARSONATE] == * common-name: ** methylarsonate * smiles: ** c[as](=o)([o-])...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18666 CPD-18666] == * common-name: ** epoxypheophorbide a * smiles: ** ccc1(=c(c)c3(=nc1=cc...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18666 CPD-18666] == |
* common-name: | * common-name: | ||
| − | ** | + | ** epoxypheophorbide a |
* smiles: | * smiles: | ||
| − | ** c[ | + | ** ccc1(=c(c)c3(=nc1=cc6(=c(c)c7(c(=o)[c-](c(oc)=o)c(=c2(c(ccc(=o)[o-])c(c)c(=n2)c=c5(c(c)=c(c=c)c4(oc34)(n5))))c(n6)=7)))) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** zmtpzdvbgynplz-ygowezgdsa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 606.677 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-17252]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=epoxypheophorbide a}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=zmtpzdvbgynplz-ygowezgdsa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=606.677}} |
Revision as of 14:20, 26 August 2019
Contents
Metabolite CPD-18666
- common-name:
- epoxypheophorbide a
- smiles:
- ccc1(=c(c)c3(=nc1=cc6(=c(c)c7(c(=o)[c-](c(oc)=o)c(=c2(c(ccc(=o)[o-])c(c)c(=n2)c=c5(c(c)=c(c=c)c4(oc34)(n5))))c(n6)=7))))
- inchi-key:
- zmtpzdvbgynplz-ygowezgdsa-m
- molecular-weight:
- 606.677
