Difference between revisions of "SJ22334"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18666 CPD-18666] == * common-name: ** epoxypheophorbide a * smiles: ** ccc1(=c(c)c3(=nc1=cc...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LysW-L-glutamate-5-phosphate LysW-L-glutamate-5-phosphate] == * common-name: ** a [2-aminoadipa...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18666 CPD-18666] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LysW-L-glutamate-5-phosphate LysW-L-glutamate-5-phosphate] ==
 
* common-name:
 
* common-name:
** epoxypheophorbide a
+
** a [2-aminoadipate carrier protein]-l-glutamate 5-phosphate
* smiles:
 
** ccc1(=c(c)c3(=nc1=cc6(=c(c)c7(c(=o)[c-](c(oc)=o)c(=c2(c(ccc(=o)[o-])c(c)c(=n2)c=c5(c(c)=c(c=c)c4(oc34)(n5))))c(n6)=7))))
 
* inchi-key:
 
** zmtpzdvbgynplz-ygowezgdsa-m
 
* molecular-weight:
 
** 606.677
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-15006]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-17252]]
+
* [[RXN-15005]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=epoxypheophorbide a}}
+
{{#set: common-name=a [2-aminoadipate carrier protein]-l-glutamate 5-phosphate}}
{{#set: inchi-key=inchikey=zmtpzdvbgynplz-ygowezgdsa-m}}
 
{{#set: molecular-weight=606.677}}
 

Revision as of 09:24, 27 August 2019

Metabolite LysW-L-glutamate-5-phosphate

  • common-name:
    • a [2-aminoadipate carrier protein]-l-glutamate 5-phosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [2-aminoadipate carrier protein]-l-glutamate 5-phosphate" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.