Difference between revisions of "SJ22474"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12120 CPD-12120] == * common-name: ** demethylmenaquinol-11 * smiles: ** cc(=cccc(=cccc(=cc...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Charged-ALA-tRNAs Charged-ALA-tRNAs] == * common-name: ** an l-alanyl-[trnaala] == Reaction(s)...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12120 CPD-12120] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Charged-ALA-tRNAs Charged-ALA-tRNAs] ==
 
* common-name:
 
* common-name:
** demethylmenaquinol-11
+
** an l-alanyl-[trnaala]
* smiles:
 
** cc(=cccc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c=c(o)c2(c=cc=cc(c(o)=1)=2)))c)c)c
 
* inchi-key:
 
** wvrzwraihitkpi-sokmhqjssa-n
 
* molecular-weight:
 
** 909.472
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-9362]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[ALANINE--TRNA-LIGASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=demethylmenaquinol-11}}
+
{{#set: common-name=an l-alanyl-[trnaala]}}
{{#set: inchi-key=inchikey=wvrzwraihitkpi-sokmhqjssa-n}}
 
{{#set: molecular-weight=909.472}}
 

Revision as of 09:24, 27 August 2019

Metabolite Charged-ALA-tRNAs

  • common-name:
    • an l-alanyl-[trnaala]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "an l-alanyl-[trnaala" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.