Difference between revisions of "SJ22523"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19162 CPD-19162] == * common-name: ** (2e,9z)-hexadecenoyl-coa * smiles: ** ccccccc=ccccccc...")
(Created page with "Category:gene == Gene SJ05273 == * transcription-direction: ** positive * right-end-position: ** 21771 * left-end-position: ** 4279 * centisome-position: ** 4.525887 =...")
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19162 CPD-19162] ==
+
== Gene SJ05273 ==
* common-name:
+
* transcription-direction:
** (2e,9z)-hexadecenoyl-coa
+
** positive
* smiles:
+
* right-end-position:
** ccccccc=ccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** 21771
* inchi-key:
+
* left-end-position:
** beqwcbbskhmrca-henmzmgosa-j
+
** 4279
* molecular-weight:
+
* centisome-position:
** 997.883
+
** 4.525887   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[RXN-17789]]
+
* [[S.japonica_sterols_curated]]
== Reaction(s) known to produce the compound ==
+
== Reaction(s) associated ==
* [[RXN-17788]]
+
* [[PEPTIDYLPROLYL-ISOMERASE-RXN]]
== Reaction(s) of unknown directionality ==
+
** Category: [[annotation]]
{{#set: common-name=(2e,9z)-hexadecenoyl-coa}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
{{#set: inchi-key=inchikey=beqwcbbskhmrca-henmzmgosa-j}}
+
** Category: [[orthology]]
{{#set: molecular-weight=997.883}}
+
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 +
{{#set: transcription-direction=positive}}
 +
{{#set: right-end-position=21771}}
 +
{{#set: left-end-position=4279}}
 +
{{#set: centisome-position=4.525887    }}
 +
{{#set: organism associated=S.japonica_sterols_curated}}
 +
{{#set: nb reaction associated=1}}

Revision as of 20:21, 18 December 2020

Gene SJ05273

  • transcription-direction:
    • positive
  • right-end-position:
    • 21771
  • left-end-position:
    • 4279
  • centisome-position:
    • 4.525887

Organism(s) associated with this gene

Reaction(s) associated