Difference between revisions of "SJ22541"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-hydroxypimeloyl-ACP-methyl-esters 3-hydroxypimeloyl-ACP-methyl-esters] == * common-name: ** a...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-METHYL-RS-TETRAHYDROBENZYLISOQUINOL N-METHYL-RS-TETRAHYDROBENZYLISOQUINOL] == * common-name:...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-hydroxypimeloyl-ACP-methyl-esters 3-hydroxypimeloyl-ACP-methyl-esters] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-METHYL-RS-TETRAHYDROBENZYLISOQUINOL N-METHYL-RS-TETRAHYDROBENZYLISOQUINOL] ==
 
* common-name:
 
* common-name:
** a (3r)-3-hydroxypimeloyl-[acp] methyl ester
+
** n-methyl-(r,s)-tetrahydrobenzylisoquinoline
 +
* smiles:
 +
** c[n+]1(c(c2(c(cc1)=cc=cc=2))cc3(c=cc=cc=3))
 +
* inchi-key:
 +
** vkrkvllltihdef-uhfffaoysa-o
 +
* molecular-weight:
 +
** 238.352
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-11481]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-11480]]
+
* [[2.1.1.115-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a (3r)-3-hydroxypimeloyl-[acp] methyl ester}}
+
{{#set: common-name=n-methyl-(r,s)-tetrahydrobenzylisoquinoline}}
 +
{{#set: inchi-key=inchikey=vkrkvllltihdef-uhfffaoysa-o}}
 +
{{#set: molecular-weight=238.352}}

Revision as of 09:24, 27 August 2019

Metabolite N-METHYL-RS-TETRAHYDROBENZYLISOQUINOL

  • common-name:
    • n-methyl-(r,s)-tetrahydrobenzylisoquinoline
  • smiles:
    • c[n+]1(c(c2(c(cc1)=cc=cc=2))cc3(c=cc=cc=3))
  • inchi-key:
    • vkrkvllltihdef-uhfffaoysa-o
  • molecular-weight:
    • 238.352

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality