Difference between revisions of "SJ22552"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHOSPHORIBOSYL-CARBOXY-AMINOIMIDAZOLE PHOSPHORIBOSYL-CARBOXY-AMINOIMIDAZOLE] == * common-name:...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Wound-RNA Wound-RNA] == * common-name: ** wound rna == Reaction(s) known to consume the compoun...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHOSPHORIBOSYL-CARBOXY-AMINOIMIDAZOLE PHOSPHORIBOSYL-CARBOXY-AMINOIMIDAZOLE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Wound-RNA Wound-RNA] ==
 
* common-name:
 
* common-name:
** 5-amino-1-(5-phospho-d-ribosyl)imidazole-4-carboxylate
+
** wound rna
* smiles:
 
** c(op([o-])([o-])=o)c2(c(o)c(o)c(n1(c=nc(c([o-])=o)=c(n)1))o2)
 
* inchi-key:
 
** xfvulmdjzxymsg-ziyngmlesa-k
 
* molecular-weight:
 
** 336.174
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[AIRCARBOXY-RXN]]
+
* [[RXN-11109]]
* [[SAICARSYN-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[AIRCARBOXY-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=5-amino-1-(5-phospho-d-ribosyl)imidazole-4-carboxylate}}
+
{{#set: common-name=wound rna}}
{{#set: inchi-key=inchikey=xfvulmdjzxymsg-ziyngmlesa-k}}
 
{{#set: molecular-weight=336.174}}
 

Revision as of 09:24, 27 August 2019

Metabolite Wound-RNA

  • common-name:
    • wound rna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality