Difference between revisions of "SJ22607"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1083 CPD-1083] == * common-name: ** (e)-2-methylcrotonoyl-coa * smiles: ** cc=c(c)c(=o)sccn...")
 
(Created page with "Category:gene == Gene SJ22607 == * transcription-direction: ** positive * right-end-position: ** 64215 * left-end-position: ** 32556 * centisome-position: ** 18.83461...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
−
[[Category:metabolite]]
+
[[Category:gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1083 CPD-1083] ==
+
== Gene SJ22607 ==
−
* common-name:
+
* transcription-direction:
−
** (e)-2-methylcrotonoyl-coa
+
** positive
−
* smiles:
+
* right-end-position:
−
** cc=c(c)c(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** 64215
−
* inchi-key:
+
* left-end-position:
−
** pmwatmxoqqznbx-dkbzllmosa-j
+
** 32556
−
* molecular-weight:
+
* centisome-position:
−
** 845.604
+
** 18.83461   
−
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
−
* [[2-MEBUCOA-FAD-RXN]]
+
* [[S.japonica_carotenoid_curated]]
−
* [[ECH_LPAREN_3hmbcoa_RPAREN_]]
+
== Reaction(s) associated ==
−
* [[RXN-14266]]
+
* [[2.5.1.64-RXN]]
−
* [[TIGLYLCOA-HYDROXY-RXN]]
+
** Category: [[annotation]]
−
== Reaction(s) known to produce the compound ==
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
* [[2-MEBUCOA-FAD-RXN]]
+
== Pathway(s) associated ==
−
* [[MCDH_LPAREN_2mb2coa_RPAREN_]]
+
* [[PWY-5837]]
−
* [[RXN-14266]]
+
** '''4''' reactions found over '''7''' reactions in the full pathway
−
* [[TIGLYLCOA-HYDROXY-RXN]]
+
{{#set: transcription-direction=positive}}
−
== Reaction(s) of unknown directionality ==
+
{{#set: right-end-position=64215}}
−
{{#set: common-name=(e)-2-methylcrotonoyl-coa}}
+
{{#set: left-end-position=32556}}
−
{{#set: inchi-key=inchikey=pmwatmxoqqznbx-dkbzllmosa-j}}
+
{{#set: centisome-position=18.83461    }}
−
{{#set: molecular-weight=845.604}}
+
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=1}}
 +
{{#set: nb pathway associated=1}}

Latest revision as of 11:02, 18 March 2021

Gene SJ22607

  • transcription-direction:
    • positive
  • right-end-position:
    • 64215
  • left-end-position:
    • 32556
  • centisome-position:
    • 18.83461

Organism(s) associated with this gene

Reaction(s) associated

Pathway(s) associated

  • PWY-5837
    • 4 reactions found over 7 reactions in the full pathway




Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=SJ22607&oldid=132631"