Difference between revisions of "SJ22607"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1083 CPD-1083] == * common-name: ** (e)-2-methylcrotonoyl-coa * smiles: ** cc=c(c)c(=o)sccn...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12018 CPD-12018] == * common-name: ** 5-methoxytryptamine * smiles: ** coc2(c=cc1(=c(c(ccn)...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1083 CPD-1083] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12018 CPD-12018] ==
 
* common-name:
 
* common-name:
** (e)-2-methylcrotonoyl-coa
+
** 5-methoxytryptamine
 
* smiles:
 
* smiles:
** cc=c(c)c(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** coc2(c=cc1(=c(c(ccn)=cn1)c=2))
 
* inchi-key:
 
* inchi-key:
** pmwatmxoqqznbx-dkbzllmosa-j
+
** jtejppkmybdemy-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 845.604
+
** 190.244
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2-MEBUCOA-FAD-RXN]]
+
* [[RXN-11067]]
* [[ECH_LPAREN_3hmbcoa_RPAREN_]]
 
* [[RXN-14266]]
 
* [[TIGLYLCOA-HYDROXY-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2-MEBUCOA-FAD-RXN]]
 
* [[MCDH_LPAREN_2mb2coa_RPAREN_]]
 
* [[RXN-14266]]
 
* [[TIGLYLCOA-HYDROXY-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(e)-2-methylcrotonoyl-coa}}
+
{{#set: common-name=5-methoxytryptamine}}
{{#set: inchi-key=inchikey=pmwatmxoqqznbx-dkbzllmosa-j}}
+
{{#set: inchi-key=inchikey=jtejppkmybdemy-uhfffaoysa-n}}
{{#set: molecular-weight=845.604}}
+
{{#set: molecular-weight=190.244}}

Revision as of 14:20, 26 August 2019

Metabolite CPD-12018

  • common-name:
    • 5-methoxytryptamine
  • smiles:
    • coc2(c=cc1(=c(c(ccn)=cn1)c=2))
  • inchi-key:
    • jtejppkmybdemy-uhfffaoysa-n
  • molecular-weight:
    • 190.244

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality