Difference between revisions of "SJ22607"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12018 CPD-12018] == * common-name: ** 5-methoxytryptamine * smiles: ** coc2(c=cc1(=c(c(ccn)...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ARG-tRNAs ARG-tRNAs] == * common-name: ** a trnaarg == Reaction(s) known to consume the compoun...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12018 CPD-12018] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ARG-tRNAs ARG-tRNAs] ==
 
* common-name:
 
* common-name:
** 5-methoxytryptamine
+
** a trnaarg
* smiles:
 
** coc2(c=cc1(=c(c(ccn)=cn1)c=2))
 
* inchi-key:
 
** jtejppkmybdemy-uhfffaoysa-n
 
* molecular-weight:
 
** 190.244
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-11067]]
+
* [[ARGININE--TRNA-LIGASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[ARGINYLTRANSFERASE-RXN]]
 +
* [[RXN-17888]]
 +
* [[RXN-17889]]
 +
* [[RXN-17890]]
 +
* [[RXN-17891]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=5-methoxytryptamine}}
+
{{#set: common-name=a trnaarg}}
{{#set: inchi-key=inchikey=jtejppkmybdemy-uhfffaoysa-n}}
 
{{#set: molecular-weight=190.244}}
 

Revision as of 09:24, 27 August 2019

Metabolite ARG-tRNAs

  • common-name:
    • a trnaarg

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality