Difference between revisions of "SJ22623"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15924 CPD-15924] == * common-name: ** 1-oleoyl-2-lyso-glycerone phosphate * smiles: ** cccc...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Carotenoid-psi-end-group Carotenoid-psi-end-group] == * common-name: ** a carotenoid ψ-end...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15924 CPD-15924] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Carotenoid-psi-end-group Carotenoid-psi-end-group] ==
 
* common-name:
 
* common-name:
** 1-oleoyl-2-lyso-glycerone phosphate
+
** a carotenoid ψ-end group
* smiles:
 
** ccccccccc=ccccccccc(=o)occ(cop([o-])([o-])=o)=o
 
* inchi-key:
 
** yzkfnnqaebncen-ktkrtigzsa-l
 
* molecular-weight:
 
** 432.493
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-12496]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-15044]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1-oleoyl-2-lyso-glycerone phosphate}}
+
{{#set: common-name=a carotenoid ψ-end group}}
{{#set: inchi-key=inchikey=yzkfnnqaebncen-ktkrtigzsa-l}}
 
{{#set: molecular-weight=432.493}}
 

Revision as of 09:24, 27 August 2019

Metabolite Carotenoid-psi-end-group

  • common-name:
    • a carotenoid ψ-end group

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality