Difference between revisions of "SN-GERANYLGERANYLGLYCERYL-1-PHOSPHATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-667 == * common-name: ** o-acetyl-l-homoserine * smiles: ** cc(occc(c([o-])=o)[n+])=o * inchi-key: ** fcxzbwsiaggpcb-yfkpbyrvsa-n * m...") |
(Created page with "Category:metabolite == Metabolite Guanine1575-in-18StRNAs == * common-name: ** a guanine1575 in 18s trna == Reaction(s) known to consume the compound == * RXN-15842 ==...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Guanine1575-in-18StRNAs == |
* common-name: | * common-name: | ||
| − | ** | + | ** a guanine1575 in 18s trna |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-15842]] |
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a guanine1575 in 18s trna}} |
| − | |||
| − | |||
Revision as of 11:12, 15 January 2021
Contents
Metabolite Guanine1575-in-18StRNAs
- common-name:
- a guanine1575 in 18s trna
