Difference between revisions of "SN-GERANYLGERANYLGLYCERYL-1-PHOSPHATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Guanine1575-in-18StRNAs == * common-name: ** a guanine1575 in 18s trna == Reaction(s) known to consume the compound == * RXN-15842 ==...") |
(Created page with "Category:metabolite == Metabolite SN-GERANYLGERANYLGLYCERYL-1-PHOSPHATE == * common-name: ** 3-(o-geranylgeranyl)-sn-glycerol 1-phosphate * smiles: ** cc(c)=cccc(c)=cccc(c...") |
||
| (One intermediate revision by one other user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite SN-GERANYLGERANYLGLYCERYL-1-PHOSPHATE == |
* common-name: | * common-name: | ||
| − | ** | + | ** 3-(o-geranylgeranyl)-sn-glycerol 1-phosphate |
| + | * smiles: | ||
| + | ** cc(c)=cccc(c)=cccc(c)=cccc(c)=ccocc(cop([o-])([o-])=o)o | ||
| + | * inchi-key: | ||
| + | ** bjlpwucpfajinb-uaqstnrtsa-l | ||
| + | * molecular-weight: | ||
| + | ** 442.531 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN | + | * [[2.5.1.42-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[2.5.1.41-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=3-(o-geranylgeranyl)-sn-glycerol 1-phosphate}} |
| + | {{#set: inchi-key=inchikey=bjlpwucpfajinb-uaqstnrtsa-l}} | ||
| + | {{#set: molecular-weight=442.531}} | ||
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite SN-GERANYLGERANYLGLYCERYL-1-PHOSPHATE
- common-name:
- 3-(o-geranylgeranyl)-sn-glycerol 1-phosphate
- smiles:
- cc(c)=cccc(c)=cccc(c)=cccc(c)=ccocc(cop([o-])([o-])=o)o
- inchi-key:
- bjlpwucpfajinb-uaqstnrtsa-l
- molecular-weight:
- 442.531
